C26H34F3N5O4S — CID 67772924
(2S)-N-[(E,3S)-6-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67772924) has the molecular formula C26H34F3N5O4S and a molecular weight of 569.65 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-6-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-[(E,3S)-6-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67772924 |
| Molecular Formula | C26H34F3N5O4S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | (2S)-N-[(E,3S)-6-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)c1nnc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)[C@@H]2CCCCN2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H33N5O2S.C2HF3O2/c1-24(2,3)22-28-29-23(32-22)27-20(30)15-14-18(13-12-17-9-5-4-6-10-17)26-21(31)19-11-7-8-16-25-19;3-2(4,5)1(6)7/h4-6,9-10,14-15,18-19,25H,7-8,11-13,16H2,1-3H3,(H,26,31)(H,27,29,30);(H,6,7)/b15-14+;/t18-,19-;/m0./s1 |
| InChIKey | PNMWOZFMJHYLSN-HUNIBTETSA-N |
| XLogP | 4.22 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|