C23H25F6N5O4S — CID 173339504
(2S)-N-[(3S)-6-oxo-1-phenyl-6-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 173339504) has the molecular formula C23H25F6N5O4S and a molecular weight of 581.54 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-oxo-1-phenyl-6-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-[(3S)-6-oxo-1-phenyl-6-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173339504 |
| Molecular Formula | C23H25F6N5O4S |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | (2S)-N-[(3S)-6-oxo-1-phenyl-6-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C=C[C@H](CCc1ccccc1)NC(=O)[C@@H]1CCCCN1)Nc1nnc(C(F)(F)F)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24F3N5O2S.C2HF3O2/c22-21(23,24)19-28-29-20(32-19)27-17(30)12-11-15(10-9-14-6-2-1-3-7-14)26-18(31)16-8-4-5-13-25-16;3-2(4,5)1(6)7/h1-3,6-7,11-12,15-16,25H,4-5,8-10,13H2,(H,26,31)(H,27,29,30);(H,6,7)/t15-,16-;/m0./s1 |
| InChIKey | JKBPBDGMQARWTI-MOGJOVFKSA-N |
| XLogP | 3.94 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|