C28H36F3N5O4S — CID 67772621
(2S)-N-[(E,3S)-6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67772621) has the molecular formula C28H36F3N5O4S and a molecular weight of 595.69 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-[(E,3S)-6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67772621 |
| Molecular Formula | C28H36F3N5O4S |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2S)-N-[(E,3S)-6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(/C=C/[C@H](CCc1ccccc1)NC(=O)[C@@H]1CCCCN1)Nc1nnc(C2CCCCC2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H35N5O2S.C2HF3O2/c32-23(29-26-31-30-25(34-26)20-11-5-2-6-12-20)17-16-21(15-14-19-9-3-1-4-10-19)28-24(33)22-13-7-8-18-27-22;3-2(4,5)1(6)7/h1,3-4,9-10,16-17,20-22,27H,2,5-8,11-15,18H2,(H,28,33)(H,29,31,32);(H,6,7)/b17-16+;/t21-,22-;/m0./s1 |
| InChIKey | VULBSZACYPACFH-AIFOEMHCSA-N |
| XLogP | 4.97 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|