C26H35N5O2S — CID 75586429
N-[6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide (PubChem CID 75586429) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is N-[6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide.
| Compound Name | N-[6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 75586429 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-[6-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
| SMILES | O=C(C=CC(CCc1ccccc1)NC(=O)C1CCCCN1)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C26H35N5O2S/c32-23(29-26-31-30-25(34-26)20-11-5-2-6-12-20)17-16-21(15-14-19-9-3-1-4-10-19)28-24(33)22-13-7-8-18-27-22/h1,3-4,9-10,16-17,20-22,27H,2,5-8,11-15,18H2,(H,28,33)(H,29,31,32) |
| InChIKey | YOLDFYBNSBABMN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|