C19H22FN5O2S — CID 123596455
N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-5-oxopent-3-en-2-yl]piperidine-2-carboxamide (PubChem CID 123596455) has the molecular formula C19H22FN5O2S and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-5-oxopent-3-en-2-yl]piperidine-2-carboxamide.
| Compound Name | N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-5-oxopent-3-en-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 123596455 |
| Molecular Formula | C19H22FN5O2S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[5-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-5-oxopent-3-en-2-yl]piperidine-2-carboxamide |
| SMILES | CC(C=CC(=O)Nc1nnc(-c2ccc(F)cc2)s1)NC(=O)C1CCCCN1 |
| InChI | InChI=1S/C19H22FN5O2S/c1-12(22-17(27)15-4-2-3-11-21-15)5-10-16(26)23-19-25-24-18(28-19)13-6-8-14(20)9-7-13/h5-10,12,15,21H,2-4,11H2,1H3,(H,22,27)(H,23,25,26) |
| InChIKey | LTOZDWMLYRGCKI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|