C21H28F3N3O4 — CID 67774164
(2S)-2-amino-N-[(4S)-1-(2,3-dihydroindol-1-yl)-1-oxohept-2-en-4-yl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 67774164) has the molecular formula C21H28F3N3O4 and a molecular weight of 443.47 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4S)-1-(2,3-dihydroindol-1-yl)-1-oxohept-2-en-4-yl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-N-[(4S)-1-(2,3-dihydroindol-1-yl)-1-oxohept-2-en-4-yl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67774164 |
| Molecular Formula | C21H28F3N3O4 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | (2S)-2-amino-N-[(4S)-1-(2,3-dihydroindol-1-yl)-1-oxohept-2-en-4-yl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC[C@@H](C=CC(=O)N1CCc2ccccc21)NC(=O)[C@@H](N)CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O2.C2HF3O2/c1-3-7-15(21-19(24)16(20)4-2)10-11-18(23)22-13-12-14-8-5-6-9-17(14)22;3-2(4,5)1(6)7/h5-6,8-11,15-16H,3-4,7,12-13,20H2,1-2H3,(H,21,24);(H,6,7)/t15-,16-;/m0./s1 |
| InChIKey | MZLSHEXHRKKYBL-MOGJOVFKSA-N |
| XLogP | 2.79 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|