C22H28F3N3O4 — CID 67774225
(2S)-2-amino-N-[(E,3S)-6-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-6-oxohex-4-en-3-yl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 67774225) has the molecular formula C22H28F3N3O4 and a molecular weight of 455.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[(E,3S)-6-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-6-oxohex-4-en-3-yl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-N-[(E,3S)-6-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-6-oxohex-4-en-3-yl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67774225 |
| Molecular Formula | C22H28F3N3O4 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (2S)-2-amino-N-[(E,3S)-6-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-6-oxohex-4-en-3-yl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](/C=C/C(=O)N1[C@@H]2CC[C@H]1c1ccccc12)NC(=O)[C@@H](N)CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O2.C2HF3O2/c1-3-13(22-20(25)16(21)4-2)9-12-19(24)23-17-10-11-18(23)15-8-6-5-7-14(15)17;3-2(4,5)1(6)7/h5-9,12-13,16-18H,3-4,10-11,21H2,1-2H3,(H,22,25);(H,6,7)/b12-9+;/t13-,16-,17-,18+;/m0./s1 |
| InChIKey | JWJYBMGWOZILMR-LJOZFCSHSA-N |
| XLogP | 3.23 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|