C28H34F3N3O4 — CID 67774222
(2S,3R)-2-[[(E,3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]amino]-3-methylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 67774222) has the molecular formula C28H34F3N3O4 and a molecular weight of 533.59 g/mol. Its IUPAC name is (2S,3R)-2-[[(E,3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]amino]-3-methylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3R)-2-[[(E,3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]amino]-3-methylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67774222 |
| Molecular Formula | C28H34F3N3O4 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | (2S,3R)-2-[[(E,3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]amino]-3-methylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](C)[C@H](N[C@H](/C=C/C(=O)N1Cc2ccccc2C1)CCc1ccccc1)C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H33N3O2.C2HF3O2/c1-3-19(2)25(26(27)31)28-23(14-13-20-9-5-4-6-10-20)15-16-24(30)29-17-21-11-7-8-12-22(21)18-29;3-2(4,5)1(6)7/h4-12,15-16,19,23,25,28H,3,13-14,17-18H2,1-2H3,(H2,27,31);(H,6,7)/b16-15+;/t19-,23+,25+;/m1./s1 |
| InChIKey | NQYNZPFBWQICDZ-PKAQJSHDSA-N |
| XLogP | 4.21 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|