C26H33N3O2 — CID 77352401
2-amino-N-[6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]-3-methylpentanamide (PubChem CID 77352401) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-amino-N-[6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 77352401 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2-amino-N-[6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NC(C=CC(=O)N1Cc2ccccc2C1)CCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O2/c1-3-19(2)25(27)26(31)28-23(14-13-20-9-5-4-6-10-20)15-16-24(30)29-17-21-11-7-8-12-22(21)18-29/h4-12,15-16,19,23,25H,3,13-14,17-18,27H2,1-2H3,(H,28,31) |
| InChIKey | AYYXYDVZYCTMIH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|