C18H27N3O2 — CID 50938680
(E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-6-phenyl-N-propylhex-2-enamide (PubChem CID 50938680) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-6-phenyl-N-propylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-6-phenyl-N-propylhex-2-enamide |
|---|---|
| PubChem CID | 50938680 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-6-phenyl-N-propylhex-2-enamide |
| SMILES | CCCNC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C18H27N3O2/c1-3-13-20-17(22)12-11-16(21-18(23)14(2)19)10-9-15-7-5-4-6-8-15/h4-8,11-12,14,16H,3,9-10,13,19H2,1-2H3,(H,20,22)(H,21,23)/b12-11+/t14-,16-/m0/s1 |
| InChIKey | GKXWPUZXJTYZKI-FCBZUWDESA-N |
| XLogP | 1.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|