C24H34F3N3O4 — CID 67773918
(4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(2-methylcyclohexyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 67773918) has the molecular formula C24H34F3N3O4 and a molecular weight of 485.55 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(2-methylcyclohexyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(2-methylcyclohexyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67773918 |
| Molecular Formula | C24H34F3N3O4 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(2-methylcyclohexyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCCCC1NC(=O)C=C[C@H](CCc1ccccc1)NC(=O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H33N3O2.C2HF3O2/c1-16-8-6-7-11-20(16)25-21(26)15-14-19(24-22(27)17(2)23)13-12-18-9-4-3-5-10-18;3-2(4,5)1(6)7/h3-5,9-10,14-17,19-20H,6-8,11-13,23H2,1-2H3,(H,24,27)(H,25,26);(H,6,7)/t16?,17-,19-,20?;/m0./s1 |
| InChIKey | CASJUXXHLOWOHC-IJVSMGQHSA-N |
| XLogP | 3.34 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|