C22H27N3O3 — CID 50939161
(E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide (PubChem CID 50939161) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide |
|---|---|
| PubChem CID | 50939161 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-16(23)22(27)25-19(9-8-17-6-4-3-5-7-17)12-15-21(26)24-18-10-13-20(28-2)14-11-18/h3-7,10-16,19H,8-9,23H2,1-2H3,(H,24,26)(H,25,27)/b15-12+/t16-,19-/m0/s1 |
| InChIKey | FRMOWUQQIIEKQV-MLHMOSTNSA-N |
| XLogP | 2.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|