C26H33N3O3 — CID 50939033
(E,4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide (PubChem CID 50939033) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide |
|---|---|
| PubChem CID | 50939033 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)[C@@H](N)C2CCCC2)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-32-23-16-13-21(14-17-23)28-24(30)18-15-22(12-11-19-7-3-2-4-8-19)29-26(31)25(27)20-9-5-6-10-20/h2-4,7-8,13-18,20,22,25H,5-6,9-12,27H2,1H3,(H,28,30)(H,29,31)/b18-15+/t22-,25-/m0/s1 |
| InChIKey | NVRUZKHFVLNDGJ-PYRLIESWSA-N |
| XLogP | 3.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|