C28H36N3O5- — CID 86666411
N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxobutan-2-yl]carbamate (PubChem CID 86666411) has the molecular formula C28H36N3O5- and a molecular weight of 494.61 g/mol. Its IUPAC name is N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86666411 |
| Molecular Formula | C28H36N3O5- |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC[C@@H](C(=O)N[C@H](/C=C/C(=O)Nc1ccc(OC)cc1)CCc1ccccc1)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C28H37N3O5/c1-6-24(31(27(34)35)28(2,3)4)26(33)30-22(13-12-20-10-8-7-9-11-20)16-19-25(32)29-21-14-17-23(36-5)18-15-21/h7-11,14-19,22,24H,6,12-13H2,1-5H3,(H,29,32)(H,30,33)(H,34,35)/p-1/b19-16+/t22-,24-/m0/s1 |
| InChIKey | VBEBWAGTNWLBRX-PPIOEHGWSA-M |
| XLogP | 3.53 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|