C27H34N3O4- — CID 86666400
N-[(2S)-1-[[(E,3S)-6-(benzylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate (PubChem CID 86666400) has the molecular formula C27H34N3O4- and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[(2S)-1-[[(E,3S)-6-(benzylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate.
| Compound Name | N-[(2S)-1-[[(E,3S)-6-(benzylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 86666400 |
| Molecular Formula | C27H34N3O4- |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[(2S)-1-[[(E,3S)-6-(benzylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate |
| SMILES | C[C@@H](C(=O)N[C@H](/C=C/C(=O)NCc1ccccc1)CCc1ccccc1)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C27H35N3O4/c1-20(30(26(33)34)27(2,3)4)25(32)29-23(16-15-21-11-7-5-8-12-21)17-18-24(31)28-19-22-13-9-6-10-14-22/h5-14,17-18,20,23H,15-16,19H2,1-4H3,(H,28,31)(H,29,32)(H,33,34)/p-1/b18-17+/t20-,23-/m0/s1 |
| InChIKey | GRTCSHZIUGLULD-CUBNLNSISA-M |
| XLogP | 2.81 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|