C22H32N3O4- — CID 86666401
N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(dimethylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 86666401) has the molecular formula C22H32N3O4- and a molecular weight of 402.52 g/mol. Its IUPAC name is N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(dimethylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(dimethylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86666401 |
| Molecular Formula | C22H32N3O4- |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(dimethylamino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](C(=O)N[C@H](/C=C/C(=O)N(C)C)CCc1ccccc1)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C22H33N3O4/c1-16(25(21(28)29)22(2,3)4)20(27)23-18(14-15-19(26)24(5)6)13-12-17-10-8-7-9-11-17/h7-11,14-16,18H,12-13H2,1-6H3,(H,23,27)(H,28,29)/p-1/b15-14+/t16-,18-/m0/s1 |
| InChIKey | HKMDTNAVXMBUFO-YARQWZEPSA-M |
| XLogP | 1.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|