C26H36N3O4- — CID 86666406
N-[(2S)-1-[[(E,4S,5S)-1-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-5-methyl-1-oxohept-2-en-4-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate (PubChem CID 86666406) has the molecular formula C26H36N3O4- and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[(2S)-1-[[(E,4S,5S)-1-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-5-methyl-1-oxohept-2-en-4-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate.
| Compound Name | N-[(2S)-1-[[(E,4S,5S)-1-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-5-methyl-1-oxohept-2-en-4-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 86666406 |
| Molecular Formula | C26H36N3O4- |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | N-[(2S)-1-[[(E,4S,5S)-1-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]-5-methyl-1-oxohept-2-en-4-yl]amino]-1-oxopropan-2-yl]-N-tert-butylcarbamate |
| SMILES | CC[C@H](C)[C@@H](/C=C/C(=O)N1[C@@H]2CC[C@H]1c1ccccc12)NC(=O)[C@H](C)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C26H37N3O4/c1-7-16(2)20(27-24(31)17(3)29(25(32)33)26(4,5)6)12-15-23(30)28-21-13-14-22(28)19-11-9-8-10-18(19)21/h8-12,15-17,20-22H,7,13-14H2,1-6H3,(H,27,31)(H,32,33)/p-1/b15-12+/t16-,17-,20+,21-,22+/m0/s1 |
| InChIKey | PRPURCYJCLQQFV-NVYZVRPZSA-M |
| XLogP | 3.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|