C19H27N3O2 — CID 67772920
(2S)-2-[[(E,4S,5S)-1-(1,3-dihydroisoindol-2-yl)-5-methyl-1-oxohept-2-en-4-yl]amino]propanamide (PubChem CID 67772920) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2S)-2-[[(E,4S,5S)-1-(1,3-dihydroisoindol-2-yl)-5-methyl-1-oxohept-2-en-4-yl]amino]propanamide.
| Compound Name | (2S)-2-[[(E,4S,5S)-1-(1,3-dihydroisoindol-2-yl)-5-methyl-1-oxohept-2-en-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 67772920 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (2S)-2-[[(E,4S,5S)-1-(1,3-dihydroisoindol-2-yl)-5-methyl-1-oxohept-2-en-4-yl]amino]propanamide |
| SMILES | CC[C@H](C)[C@@H](/C=C/C(=O)N1Cc2ccccc2C1)N[C@@H](C)C(N)=O |
| InChI | InChI=1S/C19H27N3O2/c1-4-13(2)17(21-14(3)19(20)24)9-10-18(23)22-11-15-7-5-6-8-16(15)12-22/h5-10,13-14,17,21H,4,11-12H2,1-3H3,(H2,20,24)/b10-9+/t13-,14-,17+/m0/s1 |
| InChIKey | RXTXCAQNFCBUEU-IURDUMQQSA-N |
| XLogP | 1.96 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|