C22H32N2O2 — CID 159171465
(E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)non-2-ene-1,6-dione (PubChem CID 159171465) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)non-2-ene-1,6-dione.
| Compound Name | (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)non-2-ene-1,6-dione |
|---|---|
| PubChem CID | 159171465 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)non-2-ene-1,6-dione |
| SMILES | CC[C@H](N)C(=O)C[C@H](/C=C/C(=O)N1Cc2ccccc2C1)CC(C)(C)C |
| InChI | InChI=1S/C22H32N2O2/c1-5-19(23)20(25)12-16(13-22(2,3)4)10-11-21(26)24-14-17-8-6-7-9-18(17)15-24/h6-11,16,19H,5,12-15,23H2,1-4H3/b11-10+/t16-,19-/m0/s1 |
| InChIKey | KLSWMCNETMXPPW-YPTLYQBQSA-N |
| XLogP | 3.83 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|