C19H24N2O2 — CID 160601167
(E,4R)-6-[(2S)-azetidin-2-yl]-1-(1,3-dihydroisoindol-2-yl)-4-ethylhex-2-ene-1,6-dione (PubChem CID 160601167) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (E,4R)-6-[(2S)-azetidin-2-yl]-1-(1,3-dihydroisoindol-2-yl)-4-ethylhex-2-ene-1,6-dione.
| Compound Name | (E,4R)-6-[(2S)-azetidin-2-yl]-1-(1,3-dihydroisoindol-2-yl)-4-ethylhex-2-ene-1,6-dione |
|---|---|
| PubChem CID | 160601167 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (E,4R)-6-[(2S)-azetidin-2-yl]-1-(1,3-dihydroisoindol-2-yl)-4-ethylhex-2-ene-1,6-dione |
| SMILES | CC[C@@H](/C=C/C(=O)N1Cc2ccccc2C1)CC(=O)[C@@H]1CCN1 |
| InChI | InChI=1S/C19H24N2O2/c1-2-14(11-18(22)17-9-10-20-17)7-8-19(23)21-12-15-5-3-4-6-16(15)13-21/h3-8,14,17,20H,2,9-13H2,1H3/b8-7+/t14-,17-/m0/s1 |
| InChIKey | REHHYWVLSDZMEZ-KDCQFRKDSA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|