C22H31N3O2 — CID 67977438
(2S)-2-[[1-cyclohexyl-5-(1,3-dihydroisoindol-2-yl)-5-oxopent-3-en-2-yl]amino]propanamide (PubChem CID 67977438) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2S)-2-[[1-cyclohexyl-5-(1,3-dihydroisoindol-2-yl)-5-oxopent-3-en-2-yl]amino]propanamide.
| Compound Name | (2S)-2-[[1-cyclohexyl-5-(1,3-dihydroisoindol-2-yl)-5-oxopent-3-en-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 67977438 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (2S)-2-[[1-cyclohexyl-5-(1,3-dihydroisoindol-2-yl)-5-oxopent-3-en-2-yl]amino]propanamide |
| SMILES | C[C@H](NC(C=CC(=O)N1Cc2ccccc2C1)CC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C22H31N3O2/c1-16(22(23)27)24-20(13-17-7-3-2-4-8-17)11-12-21(26)25-14-18-9-5-6-10-19(18)15-25/h5-6,9-12,16-17,20,24H,2-4,7-8,13-15H2,1H3,(H2,23,27)/t16-,20?/m0/s1 |
| InChIKey | XZBCFSQDCKSBOM-DJZRFWRSSA-N |
| XLogP | 2.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|