C23H31F3N2O4 — CID 161353608
(E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)oct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 161353608) has the molecular formula C23H31F3N2O4 and a molecular weight of 456.51 g/mol. Its IUPAC name is (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)oct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)oct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161353608 |
| Molecular Formula | C23H31F3N2O4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (E,4R,7S)-7-amino-1-(1,3-dihydroisoindol-2-yl)-4-(2,2-dimethylpropyl)oct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](N)C(=O)C[C@H](/C=C/C(=O)N1Cc2ccccc2C1)CC(C)(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H30N2O2.C2HF3O2/c1-15(22)19(24)11-16(12-21(2,3)4)9-10-20(25)23-13-17-7-5-6-8-18(17)14-23;3-2(4,5)1(6)7/h5-10,15-16H,11-14,22H2,1-4H3;(H,6,7)/b10-9+;/t15-,16-;/m0./s1 |
| InChIKey | NICLSSQSLXYWRD-LLBSGEEZSA-N |
| XLogP | 4.08 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|