C29H35F3N2O4S — CID 159437596
(E,4R,7S)-7-amino-4-(cyclohexylmethyl)-1-(2,3-dihydroindol-1-yl)-8-thiophen-2-yloct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 159437596) has the molecular formula C29H35F3N2O4S and a molecular weight of 564.67 g/mol. Its IUPAC name is (E,4R,7S)-7-amino-4-(cyclohexylmethyl)-1-(2,3-dihydroindol-1-yl)-8-thiophen-2-yloct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | (E,4R,7S)-7-amino-4-(cyclohexylmethyl)-1-(2,3-dihydroindol-1-yl)-8-thiophen-2-yloct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159437596 |
| Molecular Formula | C29H35F3N2O4S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (E,4R,7S)-7-amino-4-(cyclohexylmethyl)-1-(2,3-dihydroindol-1-yl)-8-thiophen-2-yloct-2-ene-1,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](Cc1cccs1)C(=O)C[C@H](/C=C/C(=O)N1CCc2ccccc21)CC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H34N2O2S.C2HF3O2/c28-24(19-23-10-6-16-32-23)26(30)18-21(17-20-7-2-1-3-8-20)12-13-27(31)29-15-14-22-9-4-5-11-25(22)29;3-2(4,5)1(6)7/h4-6,9-13,16,20-21,24H,1-3,7-8,14-15,17-19,28H2;(H,6,7)/b13-12+;/t21-,24+;/m1./s1 |
| InChIKey | LKJXIBRKJIMRNZ-MKRGDINCSA-N |
| XLogP | 5.94 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|