C13H18N2O — CID 94373290
(2S)-2-amino-1-(1,3-dihydroisoindol-2-yl)pentan-1-one (PubChem CID 94373290) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-dihydroisoindol-2-yl)pentan-1-one.
| Compound Name | (2S)-2-amino-1-(1,3-dihydroisoindol-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 94373290 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (2S)-2-amino-1-(1,3-dihydroisoindol-2-yl)pentan-1-one |
| SMILES | CCC[C@H](N)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2O/c1-2-5-12(14)13(16)15-8-10-6-3-4-7-11(10)9-15/h3-4,6-7,12H,2,5,8-9,14H2,1H3/t12-/m0/s1 |
| InChIKey | RQEPTHMXEOUUOO-LBPRGKRZSA-N |
| XLogP | 1.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |