C25H29N3O2 — CID 67771958
(2S)-2-amino-2-cyclopropyl-N-[(3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]acetamide (PubChem CID 67771958) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (2S)-2-amino-2-cyclopropyl-N-[(3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]acetamide.
| Compound Name | (2S)-2-amino-2-cyclopropyl-N-[(3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]acetamide |
|---|---|
| PubChem CID | 67771958 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (2S)-2-amino-2-cyclopropyl-N-[(3S)-6-(1,3-dihydroisoindol-2-yl)-6-oxo-1-phenylhex-4-en-3-yl]acetamide |
| SMILES | N[C@H](C(=O)N[C@H](C=CC(=O)N1Cc2ccccc2C1)CCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C25H29N3O2/c26-24(19-11-12-19)25(30)27-22(13-10-18-6-2-1-3-7-18)14-15-23(29)28-16-20-8-4-5-9-21(20)17-28/h1-9,14-15,19,22,24H,10-13,16-17,26H2,(H,27,30)/t22-,24-/m0/s1 |
| InChIKey | SKXNAHDZMFKAFA-UPVQGACJSA-N |
| XLogP | 2.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|