C28H34F3N3O5 — CID 67772398
(4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 67772398) has the molecular formula C28H34F3N3O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67772398 |
| Molecular Formula | C28H34F3N3O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | (4S)-4-[[(2S)-2-amino-2-cyclopentylacetyl]amino]-N-(4-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(NC(=O)C=C[C@H](CCc2ccccc2)NC(=O)[C@@H](N)C2CCCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H33N3O3.C2HF3O2/c1-32-23-16-13-21(14-17-23)28-24(30)18-15-22(12-11-19-7-3-2-4-8-19)29-26(31)25(27)20-9-5-6-10-20;3-2(4,5)1(6)7/h2-4,7-8,13-18,20,22,25H,5-6,9-12,27H2,1H3,(H,28,30)(H,29,31);(H,6,7)/t22-,25-;/m0./s1 |
| InChIKey | CYYWQAPUOGYLMA-YSCHMLPRSA-N |
| XLogP | 4.46 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|