C22H26F3N3O5S — CID 67772976
(E,4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-(4-methoxyphenyl)hex-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 67772976) has the molecular formula C22H26F3N3O5S and a molecular weight of 501.53 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-(4-methoxyphenyl)hex-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-(4-methoxyphenyl)hex-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67772976 |
| Molecular Formula | C22H26F3N3O5S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-(4-methoxyphenyl)hex-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](/C=C/C(=O)Nc1ccc(OC)cc1)NC(=O)[C@@H](N)Cc1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25N3O3S.C2HF3O2/c1-3-14(23-20(25)18(21)13-17-5-4-12-27-17)8-11-19(24)22-15-6-9-16(26-2)10-7-15;3-2(4,5)1(6)7/h4-12,14,18H,3,13,21H2,1-2H3,(H,22,24)(H,23,25);(H,6,7)/b11-8+;/t14-,18-;/m0./s1 |
| InChIKey | HNDZTDCCTHWSPQ-KRBPGIJUSA-N |
| XLogP | 3.35 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|