C19H29N3O3 — CID 50939833
(E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6,6-dimethylhept-2-enamide (PubChem CID 50939833) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6,6-dimethylhept-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6,6-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 50939833 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(4-methoxyphenyl)-6,6-dimethylhept-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/[C@H](CC(C)(C)C)NC(=O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C19H29N3O3/c1-13(20)18(24)22-15(12-19(2,3)4)8-11-17(23)21-14-6-9-16(25-5)10-7-14/h6-11,13,15H,12,20H2,1-5H3,(H,21,23)(H,22,24)/b11-8+/t13-,15+/m0/s1 |
| InChIKey | LTKGIILNRWQDKF-IVHIMIEMSA-N |
| XLogP | 2.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|