C27H34N3O5- — CID 131740410
N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 131740410) has the molecular formula C27H34N3O5- and a molecular weight of 480.59 g/mol. Its IUPAC name is N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 131740410 |
| Molecular Formula | C27H34N3O5- |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-tert-butyl-N-[(2S)-1-[[(E,3S)-6-(4-methoxyanilino)-6-oxo-1-phenylhex-4-en-3-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)[C@H](C)N(C(=O)[O-])C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H35N3O5/c1-19(30(26(33)34)27(2,3)4)25(32)29-22(12-11-20-9-7-6-8-10-20)15-18-24(31)28-21-13-16-23(35-5)17-14-21/h6-10,13-19,22H,11-12H2,1-5H3,(H,28,31)(H,29,32)(H,33,34)/p-1/b18-15+/t19-,22-/m0/s1 |
| InChIKey | BNXZBDPHBMTGRI-MPIKPGADSA-M |
| XLogP | 3.14 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|