C30H40N2O5 — CID 161205632
tert-butyl N-[(E,3S,6R)-9-(4-methoxyanilino)-2-methyl-4,9-dioxo-6-(2-phenylethyl)non-7-en-3-yl]carbamate (PubChem CID 161205632) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is tert-butyl N-[(E,3S,6R)-9-(4-methoxyanilino)-2-methyl-4,9-dioxo-6-(2-phenylethyl)non-7-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E,3S,6R)-9-(4-methoxyanilino)-2-methyl-4,9-dioxo-6-(2-phenylethyl)non-7-en-3-yl]carbamate |
|---|---|
| PubChem CID | 161205632 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | tert-butyl N-[(E,3S,6R)-9-(4-methoxyanilino)-2-methyl-4,9-dioxo-6-(2-phenylethyl)non-7-en-3-yl]carbamate |
| SMILES | COc1ccc(NC(=O)/C=C/[C@H](CCc2ccccc2)CC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C30H40N2O5/c1-21(2)28(32-29(35)37-30(3,4)5)26(33)20-23(13-12-22-10-8-7-9-11-22)14-19-27(34)31-24-15-17-25(36-6)18-16-24/h7-11,14-19,21,23,28H,12-13,20H2,1-6H3,(H,31,34)(H,32,35)/b19-14+/t23-,28-/m0/s1 |
| InChIKey | ZORGHUTZULVXKR-NIJUPKNRSA-N |
| XLogP | 5.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|