C21H31NO3 — CID 10545490
tert-butyl N-[(3S)-6-benzyl-2-methyl-4-oxooct-7-en-3-yl]carbamate (PubChem CID 10545490) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6-benzyl-2-methyl-4-oxooct-7-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-6-benzyl-2-methyl-4-oxooct-7-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10545490 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl N-[(3S)-6-benzyl-2-methyl-4-oxooct-7-en-3-yl]carbamate |
| SMILES | C=CC(CC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO3/c1-7-16(13-17-11-9-8-10-12-17)14-18(23)19(15(2)3)22-20(24)25-21(4,5)6/h7-12,15-16,19H,1,13-14H2,2-6H3,(H,22,24)/t16?,19-/m0/s1 |
| InChIKey | PWGSLYBGLKTBFB-CVMIBEPCSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|