C24H28F3N3O5 — CID 67773808
(E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(3-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 67773808) has the molecular formula C24H28F3N3O5 and a molecular weight of 495.50 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(3-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(3-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67773808 |
| Molecular Formula | C24H28F3N3O5 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-(3-methoxyphenyl)-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)[C@H](C)N)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N3O3.C2HF3O2/c1-16(23)22(27)25-18(12-11-17-7-4-3-5-8-17)13-14-21(26)24-19-9-6-10-20(15-19)28-2;3-2(4,5)1(6)7/h3-10,13-16,18H,11-12,23H2,1-2H3,(H,24,26)(H,25,27);(H,6,7)/b14-13+;/t16-,18-;/m0./s1 |
| InChIKey | RWBOTCFWGTZNLQ-GIKBCRGYSA-N |
| XLogP | 3.29 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|