C23H32F3N3O4 — CID 67775138
(4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-cyclohexyl-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 67775138) has the molecular formula C23H32F3N3O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-cyclohexyl-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-cyclohexyl-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67775138 |
| Molecular Formula | C23H32F3N3O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-cyclohexyl-6-phenylhex-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](N)C(=O)N[C@H](C=CC(=O)NC1CCCCC1)CCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N3O2.C2HF3O2/c1-16(22)21(26)24-19(13-12-17-8-4-2-5-9-17)14-15-20(25)23-18-10-6-3-7-11-18;3-2(4,5)1(6)7/h2,4-5,8-9,14-16,18-19H,3,6-7,10-13,22H2,1H3,(H,23,25)(H,24,26);(H,6,7)/t16-,19-;/m0./s1 |
| InChIKey | GXOYUXGMYVZMEW-QSVLQNJRSA-N |
| XLogP | 3.09 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|