C17H25N3O2 — CID 50938788
(E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-6-phenylhex-2-enamide (PubChem CID 50938788) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-6-phenylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-6-phenylhex-2-enamide |
|---|---|
| PubChem CID | 50938788 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-6-phenylhex-2-enamide |
| SMILES | CCNC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C17H25N3O2/c1-3-19-16(21)12-11-15(20-17(22)13(2)18)10-9-14-7-5-4-6-8-14/h4-8,11-13,15H,3,9-10,18H2,1-2H3,(H,19,21)(H,20,22)/b12-11+/t13-,15-/m0/s1 |
| InChIKey | FPKCMFFGAHWZGP-BJKSPJJASA-N |
| XLogP | 1.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|