C17H24N2O3 — CID 140552299
(2R)-2-[[(2R)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]amino]-2-phenylacetic acid (PubChem CID 140552299) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R)-2-[[(2R)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[(2R)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 140552299 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2R)-2-[[(2R)-1-amino-3-cyclohexyl-1-oxopropan-2-yl]amino]-2-phenylacetic acid |
| SMILES | NC(=O)[C@@H](CC1CCCCC1)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c18-16(20)14(11-12-7-3-1-4-8-12)19-15(17(21)22)13-9-5-2-6-10-13/h2,5-6,9-10,12,14-15,19H,1,3-4,7-8,11H2,(H2,18,20)(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | TUCJBMXTXMTBJJ-HUUCEWRRSA-N |
| XLogP | 2.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |