C15H22NO4P — CID 18472816
2-[[cyclohexylmethyl(hydroxy)phosphoryl]amino]-2-phenylacetic acid (PubChem CID 18472816) has the molecular formula C15H22NO4P and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[[cyclohexylmethyl(hydroxy)phosphoryl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[cyclohexylmethyl(hydroxy)phosphoryl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 18472816 |
| Molecular Formula | C15H22NO4P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[cyclohexylmethyl(hydroxy)phosphoryl]amino]-2-phenylacetic acid |
| SMILES | O=C(O)C(NP(=O)(O)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22NO4P/c17-15(18)14(13-9-5-2-6-10-13)16-21(19,20)11-12-7-3-1-4-8-12/h2,5-6,9-10,12,14H,1,3-4,7-8,11H2,(H,17,18)(H2,16,19,20) |
| InChIKey | ABNFNHOCZNGSGT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|