C12H16NO5P — CID 22617676
2-[[hydroxy(oxolan-2-yl)phosphoryl]amino]-2-phenylacetic acid (PubChem CID 22617676) has the molecular formula C12H16NO5P and a molecular weight of 285.24 g/mol. Its IUPAC name is 2-[[hydroxy(oxolan-2-yl)phosphoryl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[hydroxy(oxolan-2-yl)phosphoryl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 22617676 |
| Molecular Formula | C12H16NO5P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[[hydroxy(oxolan-2-yl)phosphoryl]amino]-2-phenylacetic acid |
| SMILES | O=C(O)C(NP(=O)(O)C1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H16NO5P/c14-12(15)11(9-5-2-1-3-6-9)13-19(16,17)10-7-4-8-18-10/h1-3,5-6,10-11H,4,7-8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | AFHIKLMEAGJTCO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|