C14H20NO5P — CID 18472800
2-[[benzyl(hydroxy)phosphoryl]amino]-3-(oxolan-2-yl)propanoic acid (PubChem CID 18472800) has the molecular formula C14H20NO5P and a molecular weight of 313.29 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(oxolan-2-yl)propanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(oxolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 18472800 |
| Molecular Formula | C14H20NO5P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(oxolan-2-yl)propanoic acid |
| SMILES | O=C(O)C(CC1CCCO1)NP(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H20NO5P/c16-14(17)13(9-12-7-4-8-20-12)15-21(18,19)10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H,16,17)(H2,15,18,19) |
| InChIKey | CBJSYRSTJDKJBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|