C16H18NO4P — CID 54359445
2-[[hydroxy-[(4-methylphenyl)methyl]phosphoryl]amino]-2-phenylacetic acid (PubChem CID 54359445) has the molecular formula C16H18NO4P and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[[hydroxy-[(4-methylphenyl)methyl]phosphoryl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[hydroxy-[(4-methylphenyl)methyl]phosphoryl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 54359445 |
| Molecular Formula | C16H18NO4P |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[[hydroxy-[(4-methylphenyl)methyl]phosphoryl]amino]-2-phenylacetic acid |
| SMILES | Cc1ccc(CP(=O)(O)NC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18NO4P/c1-12-7-9-13(10-8-12)11-22(20,21)17-15(16(18)19)14-5-3-2-4-6-14/h2-10,15H,11H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | ULLPTCAZZJECQK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|