C13H18NO6P — CID 18403192
2-[[hydroxy-[(3-methylphenyl)methyl]phosphoryl]amino]pentanedioic acid (PubChem CID 18403192) has the molecular formula C13H18NO6P and a molecular weight of 315.26 g/mol. Its IUPAC name is 2-[[hydroxy-[(3-methylphenyl)methyl]phosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[hydroxy-[(3-methylphenyl)methyl]phosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18403192 |
| Molecular Formula | C13H18NO6P |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[[hydroxy-[(3-methylphenyl)methyl]phosphoryl]amino]pentanedioic acid |
| SMILES | Cc1cccc(CP(=O)(O)NC(CCC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C13H18NO6P/c1-9-3-2-4-10(7-9)8-21(19,20)14-11(13(17)18)5-6-12(15)16/h2-4,7,11H,5-6,8H2,1H3,(H,15,16)(H,17,18)(H2,14,19,20) |
| InChIKey | PEUZLKMPHXDVCI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|