C11H15N2O6P — CID 18403144
2-[[hydroxy(pyridin-3-ylmethyl)phosphoryl]amino]pentanedioic acid (PubChem CID 18403144) has the molecular formula C11H15N2O6P and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-[[hydroxy(pyridin-3-ylmethyl)phosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[hydroxy(pyridin-3-ylmethyl)phosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18403144 |
| Molecular Formula | C11H15N2O6P |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[[hydroxy(pyridin-3-ylmethyl)phosphoryl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NP(=O)(O)Cc1cccnc1)C(=O)O |
| InChI | InChI=1S/C11H15N2O6P/c14-10(15)4-3-9(11(16)17)13-20(18,19)7-8-2-1-5-12-6-8/h1-2,5-6,9H,3-4,7H2,(H,14,15)(H,16,17)(H2,13,18,19) |
| InChIKey | HHXIKNDUYNZTHH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|