C11H19N2O2P — CID 151854036
N-pentan-3-yl-(pyridin-3-ylmethyl)phosphonamidic acid (PubChem CID 151854036) has the molecular formula C11H19N2O2P and a molecular weight of 242.26 g/mol. Its IUPAC name is N-pentan-3-yl-(pyridin-3-ylmethyl)phosphonamidic acid.
| Compound Name | N-pentan-3-yl-(pyridin-3-ylmethyl)phosphonamidic acid |
|---|---|
| PubChem CID | 151854036 |
| Molecular Formula | C11H19N2O2P |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-pentan-3-yl-(pyridin-3-ylmethyl)phosphonamidic acid |
| SMILES | CCC(CC)NP(=O)(O)Cc1cccnc1 |
| InChI | InChI=1S/C11H19N2O2P/c1-3-11(4-2)13-16(14,15)9-10-6-5-7-12-8-10/h5-8,11H,3-4,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | SJHLVQWDTFYFKW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|