C9H15NO6P2 — CID 142636074
[1-[ethoxy(hydroxy)phosphoryl]-2-pyridin-3-ylethyl]phosphonic acid (PubChem CID 142636074) has the molecular formula C9H15NO6P2 and a molecular weight of 295.17 g/mol. Its IUPAC name is [1-[ethoxy(hydroxy)phosphoryl]-2-pyridin-3-ylethyl]phosphonic acid.
| Compound Name | [1-[ethoxy(hydroxy)phosphoryl]-2-pyridin-3-ylethyl]phosphonic acid |
|---|---|
| PubChem CID | 142636074 |
| Molecular Formula | C9H15NO6P2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | [1-[ethoxy(hydroxy)phosphoryl]-2-pyridin-3-ylethyl]phosphonic acid |
| SMILES | CCOP(=O)(O)C(Cc1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C9H15NO6P2/c1-2-16-18(14,15)9(17(11,12)13)6-8-4-3-5-10-7-8/h3-5,7,9H,2,6H2,1H3,(H,14,15)(H2,11,12,13) |
| InChIKey | LAADYYVXSODMCW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|