C19H26NO4P — CID 87871953
4-(1-diethoxyphosphoryl-2-pyridin-3-ylethyl)-2,6-dimethylphenol (PubChem CID 87871953) has the molecular formula C19H26NO4P and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-(1-diethoxyphosphoryl-2-pyridin-3-ylethyl)-2,6-dimethylphenol.
| Compound Name | 4-(1-diethoxyphosphoryl-2-pyridin-3-ylethyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 87871953 |
| Molecular Formula | C19H26NO4P |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(1-diethoxyphosphoryl-2-pyridin-3-ylethyl)-2,6-dimethylphenol |
| SMILES | CCOP(=O)(OCC)C(Cc1cccnc1)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C19H26NO4P/c1-5-23-25(22,24-6-2)18(12-16-8-7-9-20-13-16)17-10-14(3)19(21)15(4)11-17/h7-11,13,18,21H,5-6,12H2,1-4H3 |
| InChIKey | JKWCQQOWSJOGTK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|