C21H30NO3P — CID 10237295
4-[1-di(propan-2-yl)phosphoryl-2-pyridin-3-ylethyl]-2-methoxy-6-methylphenol (PubChem CID 10237295) has the molecular formula C21H30NO3P and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[1-di(propan-2-yl)phosphoryl-2-pyridin-3-ylethyl]-2-methoxy-6-methylphenol.
| Compound Name | 4-[1-di(propan-2-yl)phosphoryl-2-pyridin-3-ylethyl]-2-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 10237295 |
| Molecular Formula | C21H30NO3P |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[1-di(propan-2-yl)phosphoryl-2-pyridin-3-ylethyl]-2-methoxy-6-methylphenol |
| SMILES | COc1cc(C(Cc2cccnc2)P(=O)(C(C)C)C(C)C)cc(C)c1O |
| InChI | InChI=1S/C21H30NO3P/c1-14(2)26(24,15(3)4)20(11-17-8-7-9-22-13-17)18-10-16(5)21(23)19(12-18)25-6/h7-10,12-15,20,23H,11H2,1-6H3 |
| InChIKey | MQDXLWYFJJAFDM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|