C21H31N2O4P — CID 10158246
4-[2-di(propan-2-yloxy)phosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethylphenol (PubChem CID 10158246) has the molecular formula C21H31N2O4P and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[2-di(propan-2-yloxy)phosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethylphenol.
| Compound Name | 4-[2-di(propan-2-yloxy)phosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 10158246 |
| Molecular Formula | C21H31N2O4P |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-[2-di(propan-2-yloxy)phosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(CP(=O)(OC(C)C)OC(C)C)Nc2cccnc2)cc(C)c1O |
| InChI | InChI=1S/C21H31N2O4P/c1-14(2)26-28(25,27-15(3)4)13-20(23-19-8-7-9-22-12-19)18-10-16(5)21(24)17(6)11-18/h7-12,14-15,20,23-24H,13H2,1-6H3 |
| InChIKey | LCLXBQIQMSAEEL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|