C22H33N2O6P — CID 10114973
N-[2-di(propan-2-yloxy)phosphoryl-1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-3-amine (PubChem CID 10114973) has the molecular formula C22H33N2O6P and a molecular weight of 452.49 g/mol. Its IUPAC name is N-[2-di(propan-2-yloxy)phosphoryl-1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-3-amine.
| Compound Name | N-[2-di(propan-2-yloxy)phosphoryl-1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 10114973 |
| Molecular Formula | C22H33N2O6P |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[2-di(propan-2-yloxy)phosphoryl-1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-3-amine |
| SMILES | COc1cc(C(CP(=O)(OC(C)C)OC(C)C)Nc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H33N2O6P/c1-15(2)29-31(25,30-16(3)4)14-19(24-18-9-8-10-23-13-18)17-11-20(26-5)22(28-7)21(12-17)27-6/h8-13,15-16,19,24H,14H2,1-7H3 |
| InChIKey | DNFHYQFWMFZUAP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|