C20H29N2O6P — CID 10180695
[4-[2-diethoxyphosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethoxyphenyl]methanol (PubChem CID 10180695) has the molecular formula C20H29N2O6P and a molecular weight of 424.43 g/mol. Its IUPAC name is [4-[2-diethoxyphosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethoxyphenyl]methanol.
| Compound Name | [4-[2-diethoxyphosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 10180695 |
| Molecular Formula | C20H29N2O6P |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [4-[2-diethoxyphosphoryl-1-(pyridin-3-ylamino)ethyl]-2,6-dimethoxyphenyl]methanol |
| SMILES | CCOP(=O)(CC(Nc1cccnc1)c1cc(OC)c(CO)c(OC)c1)OCC |
| InChI | InChI=1S/C20H29N2O6P/c1-5-27-29(24,28-6-2)14-18(22-16-8-7-9-21-12-16)15-10-19(25-3)17(13-23)20(11-15)26-4/h7-12,18,22-23H,5-6,13-14H2,1-4H3 |
| InChIKey | DVUHJSWQLXRAOM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|