C9H12N2O2 — CID 90735092
2-(pyridin-3-ylamino)butanoic acid (PubChem CID 90735092) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(pyridin-3-ylamino)butanoic acid.
| Compound Name | 2-(pyridin-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 90735092 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(pyridin-3-ylamino)butanoic acid |
| SMILES | CCC(Nc1cccnc1)C(=O)O |
| InChI | InChI=1S/C9H12N2O2/c1-2-8(9(12)13)11-7-4-3-5-10-6-7/h3-6,8,11H,2H2,1H3,(H,12,13) |
| InChIKey | QLHVQNGTRXHKFV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |