C16H21N2O5P — CID 91364443
[1-(3-ethoxy-4-hydroxy-5-methylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid (PubChem CID 91364443) has the molecular formula C16H21N2O5P and a molecular weight of 352.33 g/mol. Its IUPAC name is [1-(3-ethoxy-4-hydroxy-5-methylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid.
| Compound Name | [1-(3-ethoxy-4-hydroxy-5-methylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 91364443 |
| Molecular Formula | C16H21N2O5P |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [1-(3-ethoxy-4-hydroxy-5-methylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid |
| SMILES | CCOc1cc(C(CNc2cccnc2)P(=O)(O)O)cc(C)c1O |
| InChI | InChI=1S/C16H21N2O5P/c1-3-23-14-8-12(7-11(2)16(14)19)15(24(20,21)22)10-18-13-5-4-6-17-9-13/h4-9,15,18-19H,3,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | PAYHUUOEXQACMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|